
CAS 127419-64-1
:(9S,11bR)-1,3,4,8,9,11b-Hexahydro-5,7,11-trihydroxy-4,4,9,11b-tetramethylphenanthro[3,2-b]furan-6(2H)-one
Description:
The chemical substance known as "(9S,11bR)-1,3,4,8,9,11b-Hexahydro-5,7,11-trihydroxy-4,4,9,11b-tetramethylphenanthro[3,2-b]furan-6(2H)-one," with the CAS number 127419-64-1, is a complex organic compound characterized by its multi-ring structure and multiple hydroxyl groups. This compound belongs to the class of phenanthrofurans, which are known for their diverse biological activities. The presence of multiple hydroxyl groups suggests potential for hydrogen bonding and reactivity, which may contribute to its solubility and interaction with biological systems. The stereochemistry indicated by the (9S,11bR) configuration implies specific spatial arrangements that can influence the compound's pharmacological properties and interactions with biological targets. Such compounds are often studied for their potential therapeutic applications, including anti-inflammatory and antioxidant effects. Overall, the unique structural features and functional groups of this substance make it a subject of interest in medicinal chemistry and natural product research.
Formula:C20H24O5
InChI:InChI=1S/C20H24O5/c1-9-8-10-13(21)11-12(15(23)17(10)25-9)20(4)7-5-6-19(2,3)18(20)16(24)14(11)22/h9,21,23-24H,5-8H2,1-4H3/t9-,20+/m0/s1
InChI key:InChIKey=MVLKANNSFKZLTO-GWNMQOMSSA-N
SMILES:C[C@@]12C=3C(=C(O)C4=C(C3O)O[C@@H](C)C4)C(=O)C(O)=C1C(C)(C)CCC2
Synonyms:- Phenanthro[3,2-b]furan-6(2H)-one, 1,3,4,8,9,11b-hexahydro-5,7,11-trihydroxy-4,4,9,11b-tetramethyl-, (9S,11bR)-
- (-)-Teuvincenone B
- (9S,11bR)-1,3,4,8,9,11b-Hexahydro-5,7,11-trihydroxy-4,4,9,11b-tetramethylphenanthro[3,2-b]furan-6(2H)-one
- Phenanthro[3,2-b]furan-6(2H)-one, 1,3,4,8,9,11b-hexahydro-5,7,11-trihydroxy-4,4,9,11b-tetramethyl-, (9S-cis)-
- Teuvincenone B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Phenanthro[3,2-b]furan-6(2H)-one, 1,3,4,8,9,11b-hexahydro-5,7,11-trihydroxy-4,4,9,11b-tetramethyl-, (9S,11bR)-
CAS:Formula:C20H24O5Molecular weight:344.4016Teuvincenone B
CAS:Teuvincenone B is a natural product for research related to life sciences. The catalog number is TN6168 and the CAS number is 127419-64-1.Formula:C20H24O5Purity:98%Color and Shape:SolidMolecular weight:344.4Teuvincenone B
CAS:Controlled ProductTeuvincenone B is an anticancer compound that is derived from a Chinese plant. It is an analog of ghrelin, a hormone that regulates appetite and energy balance. Teuvincenone B has been shown to induce apoptosis (programmed cell death) in tumor and cancer cells by inhibiting the activity of protein kinases, which are enzymes that regulate cell growth and division. This compound has also been found to inhibit the growth of human cancer cells in vitro, as well as in vivo studies using mice. Teuvincenone B acts as a potent inhibitor of cellulose synthase, which is required for the synthesis of cellulose, an important component of plant cell walls. Additionally, this compound has been studied as a potential treatment for various types of cancer due to its ability to inhibit the activity of certain protein kinases involved in tumorigenesis.Formula:C20H24O5Purity:Min. 95%Molecular weight:344.4 g/mol


