CAS 127427-04-7
:Trimethoxycinnamicacidsodiumsalt
Description:
Trimethoxycinnamic acid sodium salt, with the CAS number 127427-04-7, is a chemical compound that belongs to the class of cinnamic acid derivatives. It is characterized by the presence of three methoxy groups attached to the aromatic ring, which enhances its solubility and stability in aqueous environments. This compound typically exhibits properties such as being a white to off-white powder, with good solubility in water due to the sodium salt form. Trimethoxycinnamic acid sodium salt is often utilized in various applications, including as a UV filter in cosmetic formulations, owing to its ability to absorb ultraviolet radiation and protect skin from sun damage. Additionally, it may possess antioxidant properties, contributing to its effectiveness in preserving the integrity of formulations. The compound's stability and efficacy make it a valuable ingredient in personal care products, although its specific interactions and effects can vary based on formulation and concentration. As with any chemical, safety data and handling precautions should be observed when working with this substance.
Formula:C12H13NaO5
InChI:InChI=1/C12H14O5.Na/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3;/h4-7H,1-3H3,(H,13,14);/q;+1/p-1/b5-4+;
SMILES:COc1cc(C=CC(=O)O)cc(c1OC)OC.[Na]
Synonyms:- 3,4,5-Trimethoxycinnamic acid sodium salt
- sodium (2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
