
CAS 127430-56-2
:2,4,6,8-Tetrachlorononane
Description:
2,4,6,8-Tetrachlorononane is a synthetic organic compound characterized by the presence of four chlorine atoms attached to a nonane backbone, specifically at the 2, 4, 6, and 8 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is classified as a chlorinated hydrocarbon, which may exhibit hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of multiple chlorine atoms contributes to its potential environmental persistence and bioaccumulation. 2,4,6,8-Tetrachlorononane may be used in various industrial applications, including as a solvent or intermediate in chemical synthesis. However, due to its chlorinated nature, it may pose risks to human health and the environment, necessitating careful handling and regulation. Its chemical stability and reactivity can vary based on environmental conditions, influencing its degradation pathways and potential toxicity. As with many chlorinated compounds, it is essential to assess its safety and environmental impact through appropriate studies and regulations.
Formula:C9H16Cl4
InChI:InChI=1S/C9H16Cl4/c1-6(10)3-8(12)5-9(13)4-7(2)11/h6-9H,3-5H2,1-2H3
InChI key:InChIKey=FUMKFYBZZWGYBQ-UHFFFAOYSA-N
SMILES:C(CC(CC(C)Cl)Cl)(CC(C)Cl)Cl
Synonyms:- 2,4,6,8-Tetrachlorononane
- Nonane, 2,4,6,8-tetrachloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
