CAS 127437-44-9
:6-Chloropyridine-2,3-dicarboxylic acid
Description:
6-Chloropyridine-2,3-dicarboxylic acid is an organic compound characterized by its pyridine ring, which is substituted with two carboxylic acid groups and a chlorine atom. The presence of the chlorine atom at the 6-position of the pyridine ring influences its reactivity and solubility properties. This compound typically appears as a crystalline solid and is soluble in polar solvents due to the carboxylic acid groups, which can engage in hydrogen bonding. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The dicarboxylic acid functionality allows for further derivatization, making it a versatile building block in chemical synthesis. Additionally, the compound may exhibit biological activity, which can be explored in various research applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H4ClNO4
InChI:InChI=1/C7H4ClNO4/c8-4-2-1-3(6(10)11)5(9-4)7(12)13/h1-2H,(H,10,11)(H,12,13)
SMILES:c1cc(Cl)nc(c1C(=O)O)C(=O)O
Synonyms:- 6-Chloropyridine-2,3-dicarboxylicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Chloropyridine-2,3-dicarboxylic acid
CAS:6-Chloropyridine-2,3-dicarboxylic acidPurity:96%Molecular weight:201.56g/mol6-Chloropyridine-2,3-dicarboxylic acid
CAS:6-Chloropyridine-2,3-dicarboxylic acid is an oxidative tetroxide that has been used in the synthesis of 1-4c alkyl pyridinedicarboxylates. It has been shown to react with benzene and form quinoline derivatives. The compound can be used to synthesize dyestuffs. 6-Chloropyridine-2,3-dicarboxylic acid is heat sensitive and should not be exposed to heat or light.
Formula:C7H4NO4ClPurity:Min. 95%Molecular weight:201.56 g/mol
