
CAS 127448-23-1
:2-Amino-N,N-dipropylpropanamide
Description:
2-Amino-N,N-dipropylpropanamide, also known by its CAS number 127448-23-1, is an organic compound characterized by the presence of an amine and an amide functional group. It features a propanamide backbone with two propyl groups attached to the nitrogen atom, which contributes to its hydrophobic properties. The amino group (-NH2) imparts basic characteristics, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its solubility in water is moderate, influenced by the balance between its hydrophilic amine group and hydrophobic alkyl chains. 2-Amino-N,N-dipropylpropanamide may exhibit biological activity, making it of interest in pharmaceutical research and development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H20N2O
InChI:InChI=1S/C9H20N2O/c1-4-6-11(7-5-2)9(12)8(3)10/h8H,4-7,10H2,1-3H3
InChI key:InChIKey=AZHUMSKXUDUMAU-UHFFFAOYSA-N
SMILES:N(C(C(C)N)=O)(CCC)CCC
Synonyms:- Propanamide, 2-amino-N,N-dipropyl-, (±)-
- 2-Amino-N,N-dipropylpropanamide
- Propanamide, 2-amino-N,N-dipropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.