
CAS 127448-92-4
:4-(2,6-Dihydroxybenzoyl)-3-formyl-5-hydroxybenzoic acid
Description:
4-(2,6-Dihydroxybenzoyl)-3-formyl-5-hydroxybenzoic acid, with the CAS number 127448-92-4, is an organic compound characterized by its complex aromatic structure, which includes multiple hydroxyl groups and a formyl group. This compound features a benzoyl moiety substituted with hydroxyl groups at the 2 and 6 positions, contributing to its potential for hydrogen bonding and increased solubility in polar solvents. The presence of the formyl group at the 3-position enhances its reactivity, making it a candidate for various chemical transformations. The compound is likely to exhibit properties typical of phenolic compounds, such as antioxidant activity, and may have applications in pharmaceuticals, agrochemicals, or as a biochemical probe. Its structural features suggest potential for interactions with biological systems, which could be explored in medicinal chemistry. Additionally, the compound's stability and solubility characteristics would be influenced by pH and solvent conditions, making it important to consider these factors in practical applications.
Formula:C15H10O7
InChI:InChI=1S/C15H10O7/c16-6-8-4-7(15(21)22)5-11(19)12(8)14(20)13-9(17)2-1-3-10(13)18/h1-6,17-19H,(H,21,22)
InChI key:InChIKey=INVAPAXTQZQLGN-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C=O)C=C(C(O)=O)C=C1O)C2=C(O)C=CC=C2O
Synonyms:- Benzoic acid, 4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxy-
- 4-(2,6-Dihydroxybenzoyl)-3-formyl-5-hydroxybenzoic acid
- TAN 931
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Benzoic acid, 4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxy-
CAS:Formula:C15H10O7Molecular weight:302.2357Tan 931
CAS:Tan 931 is a nonsteroidal aromatase inhibitor that was first isolated from the culture filtrate of a soil isolate fungus, No. 8974Formula:C15H10O7Color and Shape:SolidMolecular weight:302.24

