CymitQuimica logo

CAS 1274702-35-0

:

9-(4-Bromophenyl)-10-phenylphenanthrene

Description:
9-(4-Bromophenyl)-10-phenylphenanthrene is an organic compound characterized by its polycyclic aromatic structure, which includes a phenanthrene core substituted with bromophenyl and phenyl groups. This compound typically exhibits properties associated with polycyclic aromatic hydrocarbons, such as high stability and potential fluorescence. The presence of the bromine atom introduces unique electronic and steric effects, which can influence its reactivity and interaction with other molecules. It may also exhibit interesting photophysical properties, making it a candidate for applications in organic electronics, such as organic light-emitting diodes (OLEDs) or organic photovoltaics. Additionally, the compound's structure suggests potential for use in materials science and medicinal chemistry, particularly in the development of new drugs or as a probe in biological systems. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, 9-(4-Bromophenyl)-10-phenylphenanthrene represents a versatile compound with potential applications in various fields of research and technology.
Formula:C26H17Br
InChI:InChI=1S/C26H17Br/c27-20-16-14-19(15-17-20)26-24-13-7-5-11-22(24)21-10-4-6-12-23(21)25(26)18-8-2-1-3-9-18/h1-17H
InChI key:InChIKey=KXPFJAIKSHJVTM-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C=2C(=C3C(=C4C2C=CC=C4)C=CC=C3)C5=CC=CC=C5)C=C1
Synonyms:
  • Phenanthrene, 9-(4-bromophenyl)-10-phenyl-
  • 9-(4-Bromophenyl)-10-phenylphenanthrene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.