CAS 127481-99-6
:2-(Bromomethyl)-5-(trifluoromethyl)quinoline
Description:
2-(Bromomethyl)-5-(trifluoromethyl)quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a bromomethyl group at the second position and a trifluoromethyl group at the fifth position significantly influences its chemical reactivity and physical properties. This compound is typically a solid at room temperature and exhibits a relatively high melting point due to the presence of strong intermolecular interactions. The trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the bromomethyl group can serve as a reactive site for further chemical modifications, allowing for the synthesis of various derivatives. Its unique structure and functional groups may contribute to potential applications in pharmaceuticals, agrochemicals, or materials science. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns.
Formula:C11H7BrF3N
InChI:InChI=1S/C11H7BrF3N/c12-6-7-4-5-8-9(11(13,14)15)2-1-3-10(8)16-7/h1-5H,6H2
InChI key:InChIKey=DMCYBCBDZQOCCE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(N=C(CBr)C=C2)C=CC1
Synonyms:- Quinoline, 2-(bromomethyl)-5-(trifluoromethyl)-
- 2-(Bromomethyl)-5-(trifluoromethyl)quinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
