CAS 127489-35-4
:6-(Phenylseleno)-2-cyclohexen-1-one
Description:
6-(Phenylseleno)-2-cyclohexen-1-one is an organoselenium compound characterized by the presence of a phenylseleno group attached to a cyclohexenone structure. This compound typically exhibits a yellow to orange coloration, which is common among organoselenium derivatives. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly due to the reactivity of the selenium atom, which can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The cyclohexenone moiety contributes to its reactivity, allowing for further functionalization. Additionally, compounds containing selenium often display interesting biological activities, including antioxidant properties. However, the specific properties such as solubility, melting point, and stability can vary based on the conditions and the presence of other functional groups. Safety considerations are important when handling organoselenium compounds, as they can be toxic and require appropriate precautions. Overall, 6-(Phenylseleno)-2-cyclohexen-1-one represents a unique structure within the realm of organoselenium chemistry, with potential utility in various chemical applications.
Formula:C12H12OSe
InChI:InChI=1S/C12H12OSe/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-4,6-8,12H,5,9H2
InChI key:InChIKey=NKLPSEHZAHVSLY-UHFFFAOYSA-N
SMILES:[Se](C1C(=O)C=CCC1)C2=CC=CC=C2
Synonyms:- 2-Cyclohexen-1-one, 6-(phenylseleno)-
- 6-(Phenylseleno)-2-cyclohexen-1-one
- 6-(Phenylseleno)cyclohex-2-enone
- 6-Phenylseleno-2-cyclohexen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
