CymitQuimica logo

CAS 1274892-06-6

:

2-Fluoro-4-[(trifluoromethyl)sulfonyl]phenol

Description:
2-Fluoro-4-[(trifluoromethyl)sulfonyl]phenol is an organic compound characterized by the presence of a fluorine atom and a trifluoromethylsulfonyl group attached to a phenolic structure. This compound features a phenol ring, which contributes to its potential as a weak acid due to the hydroxyl (-OH) group. The trifluoromethylsulfonyl group enhances its reactivity and polarity, making it useful in various chemical applications, including as a reagent in organic synthesis. The presence of fluorine atoms typically increases the compound's stability and lipophilicity, which can influence its behavior in biological systems. Additionally, the compound may exhibit unique properties such as increased solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as compounds with fluorinated groups can pose specific health and environmental risks. Overall, 2-Fluoro-4-[(trifluoromethyl)sulfonyl]phenol is a notable compound in the realm of fluorinated organic chemistry.
Formula:C7H4F4O3S
InChI:InChI=1S/C7H4F4O3S/c8-5-3-4(1-2-6(5)12)15(13,14)7(9,10)11/h1-3,12H
InChI key:InChIKey=YVMVYIUBSGCSGI-UHFFFAOYSA-N
SMILES:S(C(F)(F)F)(=O)(=O)C1=CC(F)=C(O)C=C1
Synonyms:
  • 2-Fluoro-4-[(trifluoromethyl)sulfonyl]phenol
  • Phenol, 2-fluoro-4-[(trifluoromethyl)sulfonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.