
CAS 1274903-41-1
:4-(1,1,2,2,2-Pentafluoroethoxy)piperidine
Description:
4-(1,1,2,2,2-Pentafluoroethoxy)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a pentafluoroethoxy group. This substitution imparts distinct properties to the molecule, including increased lipophilicity and potential reactivity due to the presence of multiple fluorine atoms. The pentafluoroethoxy group enhances the compound's stability and may influence its solubility in various solvents, making it of interest in both synthetic and medicinal chemistry. The presence of fluorine atoms often leads to altered biological activity and can enhance the compound's pharmacokinetic properties. Additionally, the piperidine moiety is known for its role in various biological systems and can serve as a scaffold for drug development. Overall, this compound's unique characteristics make it a subject of interest for research in fields such as pharmaceuticals, agrochemicals, and materials science. However, specific safety and handling guidelines should be followed due to the potential hazards associated with fluorinated compounds.
Formula:C7H10F5NO
InChI:InChI=1S/C7H10F5NO/c8-6(9,10)7(11,12)14-5-1-3-13-4-2-5/h5,13H,1-4H2
InChI key:InChIKey=HHSZDDMBJHDGPE-UHFFFAOYSA-N
SMILES:O(C(C(F)(F)F)(F)F)C1CCNCC1
Synonyms:- 4-(1,1,2,2,2-Pentafluoroethoxy)piperidine
- Piperidine, 4-(1,1,2,2,2-pentafluoroethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.