CAS 127512-29-2: DODAP
Description:DODAP, or dioctadecyldimethylammonium phosphate, is a quaternary ammonium compound characterized by its long hydrophobic alkyl chains and a positively charged ammonium group. It is typically used as a surfactant and emulsifying agent due to its amphiphilic nature, which allows it to interact with both hydrophilic and hydrophobic substances. DODAP is known for its ability to form stable lipid bilayers and is often utilized in the formulation of liposomes and other nanocarriers for drug delivery applications. Its structure contributes to its effectiveness in encapsulating hydrophobic drugs, enhancing their solubility and bioavailability. Additionally, DODAP exhibits biocompatibility, making it suitable for pharmaceutical and biomedical applications. However, like many quaternary ammonium compounds, it may also possess antimicrobial properties, which can be advantageous in certain formulations. Overall, DODAP's unique properties make it a valuable compound in various fields, including pharmaceuticals, cosmetics, and materials science.
Formula:C41H77NO4
InChI:InChI=1/C41H77NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40(43)45-38-39(37-42(3)4)46-41(44)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,39H,5-18,23-38H2,1-4H3/b21-19-,22-20-
- Synonyms:
- 18:1 Dap
- 1,2-Dioleoyloxy-3-(Dimethylamino)Propane
- 1,2-Dioleoyl-3-Dimethylammonium-Propane
- 3-(dimethylamino)propane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate

9-Octadecenoic acid (9Z)-, 1,1'-[1-[(dimethylamino)methyl]-1,2-ethanediyl] ester
Ref: IN-DA000X5P
1g | 610.00 € | ||
50mg | 183.00 € | ||
100mg | 199.00 € |

1,2-Dioleoyloxy-3-(dimethylamino)propane
Ref: 48-16-1801
100mg | 375.00 € |

DODAP
Ref: TM-T38679
5mg | 47.00 € | ||
10mg | 66.00 € | ||
1mL*10mM (DMSO) | 54.00 € |

3-(Dimethylamino)propane-1,2-diyl Dioleate
Ref: 3B-D6266
50mg | 206.00 € | ||
200mg | 357.00 € |

1,2-Dioleoyloxy-3-(dimethylamino)propane
Controlled ProductRef: TR-D483000
1g | 2,164.00 € | ||
100mg | 340.00 € |

1,2-Dioleoyloxy-3-(dimethylamino)propane
Ref: 3D-CFA51229
Undefined size | Discontinued | Request information | |
1kg | Discontinued | Request information | |
100g | Discontinued | Request information | |
250g | Discontinued | Request information | |
500g | Discontinued | Request information |