CAS 127512-29-2
:DODAP
Description:
DODAP, or dioctadecyldimethylammonium phosphate, is a quaternary ammonium compound characterized by its long hydrophobic alkyl chains and a positively charged ammonium group. It is typically used as a surfactant and emulsifying agent due to its amphiphilic nature, which allows it to interact with both hydrophilic and hydrophobic substances. DODAP is known for its ability to form stable lipid bilayers and is often utilized in the formulation of liposomes and other nanocarriers for drug delivery applications. Its structure contributes to its effectiveness in encapsulating hydrophobic drugs, enhancing their solubility and bioavailability. Additionally, DODAP exhibits biocompatibility, making it suitable for pharmaceutical and biomedical applications. However, like many quaternary ammonium compounds, it may also possess antimicrobial properties, which can be advantageous in certain formulations. Overall, DODAP's unique properties make it a valuable compound in various fields, including pharmaceuticals, cosmetics, and materials science.
Formula:C41H77NO4
InChI:InChI=1/C41H77NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40(43)45-38-39(37-42(3)4)46-41(44)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,39H,5-18,23-38H2,1-4H3/b21-19-,22-20-
SMILES:CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CN(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC
Synonyms:- 18:1 Dap
- 1,2-Dioleoyloxy-3-(Dimethylamino)Propane
- 1,2-Dioleoyl-3-Dimethylammonium-Propane
- 3-(dimethylamino)propane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
9-Octadecenoic acid (9Z)-, 1,1'-[1-[(dimethylamino)methyl]-1,2-ethanediyl] ester
CAS:Formula:C41H77NO4Purity:98%Color and Shape:LiquidMolecular weight:648.05441,2-Dioleoyl-3-Dimethylammonium-Propane
CAS:1,2-Dioleoyl-3-Dimethylammonium-PropanePurity:98%Molecular weight:648.05g/mol1,2-Dioleoyloxy-3-(dimethylamino)propane
CAS:Formula:C41H77NO4Purity:>98%Color and Shape:SolidMolecular weight:648.063-(Dimethylamino)propane-1,2-diyl Dioleate
CAS:Formula:C41H77NO4Purity:>95.0%(qNMR)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:648.07DODAP
CAS:DODAP is an ionic cationic lipid high transfection efficiency that can be used to synthesize liposomes and encapsulate mRNA, siRNA and plasmid DNA.Formula:C41H77NO4Purity:98.7%Color and Shape:SolidMolecular weight:648.051,2-Dioleoyloxy-3-(dimethylamino)propane
CAS:Controlled ProductApplications Cationic amphiphiles are being studied for their potential role in preparing liposomes for interaction with artificial and biological membranes and cellular transfection techniques. Cationic species with ester linkages to the hydrophobic portion are more easily degraded by recipient cells and more efficiently metabolized.
References Leventis, R., and Silvus, J.R.: Biochimica et Biophysica Acta, 1023, 124 (1990)Formula:C41H77NO4Color and Shape:NeatMolecular weight:648.05





