CAS 127514-62-9

Hydroxy-γ-isosanshool

Description:

Hydroxy-γ-isosanshool, with the CAS number 127514-62-9, is a naturally occurring compound primarily found in certain plants, particularly in the Zingiberaceae family, which includes ginger. This compound is a derivative of isosanshool, known for its unique sensory properties, contributing to the pungency and flavor profile of certain foods. Hydroxy-γ-isosanshool is characterized by its hydroxyl functional group, which influences its solubility and reactivity. It exhibits potential biological activities, including anti-inflammatory and analgesic effects, making it of interest in pharmacological research. The compound's structure allows it to interact with various biological targets, which may lead to therapeutic applications. Additionally, its sensory characteristics make it relevant in the food industry, particularly in flavoring and aroma formulations. As with many natural compounds, the specific properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the method of extraction or synthesis. Overall, Hydroxy-γ-isosanshool represents a fascinating area of study in both chemistry and biochemistry.

Formula: C₁₈H₂₇NO₂

InChI: InChI=1S/C18H27NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(20)19-16-18(2,3)21/h4-9,12-15,21H,10-11,16H2,1-3H3,(H,19,20)/b5-4+,7-6+,9-8+,13-12+,15-14+

InChI key: InChIKey=CRPPMKFSMRODIQ-FMBIJHKPSA-N

SMILES: C(\C(NCC(C)(C)O)=O)=C/C=C/CC/C=C/C=C/C=C/C

Synonyms:

• 2,4,8,10,12-Tetradecapentaenamide, N-(2-hydroxy-2-methylpropyl)-, (2E,4E,8E,10E,12E)-
• 2,4,8,10,12-Tetradecapentaenamide, N-(2-hydroxy-2-methylpropyl)-, (all-E)-
• (2E,4E,8E,10E,12E)-N-(2-Hydroxy-2-methylpropyl)-2,4,8,10,12-tetradecapentaenamide
• 2E,4E,8E,10E,12E-Tetradecapentaenoic acid N-(2-hydroxy-2-methylpropyl)amide
• Hydroxyl-γ-isosanshool

Hydroxyl-γ-isosanshool

CAS: 127514-62-9

Formula: C₁₈H₂₇NO₂

Molecular weight: 289.42

Ref: 7W-GY3103

Hydroxyl-​γ-​isosanshool

CAS: 127514-62-9

Hydroxyl-γ-isosanshool induces a numbing sensation. It is one of the major alkylamides in Z. bungeanum and Z. schinifolium oils.

Formula: C₁₈H₂₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 289.41

Ref: TM-T19363

Hydroxyl-γ-isosanshool

CAS: 127514-62-9

Formula: C₁₈H₂₇NO₂

Purity: 95%~99%

Molecular weight: 289.419

Ref: BP-BP4110

Hydroxyl-γ-isosanshool

CAS: 127514-62-9

Hydroxyl-γ-isosanshool is a bioactive compound, which is an alkylamide sourced from the pericarp of the Zanthoxylum species, commonly known as Sichuan pepper. This compound is known for its unique sensory properties, especially the tingling and numbing sensations it produces due to its interaction with specific ion channels in sensory neurons.

Formula: C₁₈H₂₇NO₂

Purity: Min. 95%

Molecular weight: 289.4 g/mol

Ref: 3D-CFA51462