CAS 127531-39-9

2-methyl-4,5-bis(phenylmethoxy)-benzoic acid

Description:

2-Methyl-4,5-bis(phenylmethoxy)-benzoic acid, with the CAS number 127531-39-9, is an organic compound characterized by its complex structure featuring a benzoic acid core substituted with two phenylmethoxy groups and a methyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points. The presence of the carboxylic acid functional group (-COOH) contributes to its acidity and potential for hydrogen bonding, influencing its solubility in polar solvents. The phenylmethoxy substituents enhance its lipophilicity, which may affect its biological activity and interactions with other molecules. Additionally, this compound may exhibit interesting photophysical properties, making it of interest in fields such as materials science and pharmaceuticals. Its synthesis and applications could be relevant in organic synthesis and medicinal chemistry, particularly in the development of new therapeutic agents or functional materials. As with any chemical, safety data and handling precautions should be observed due to potential hazards associated with its use.

Formula: C₂₂H₂₀O₄

InChI: InChI=1S/C22H20O4/c1-16-12-20(25-14-17-8-4-2-5-9-17)21(13-19(16)22(23)24)26-15-18-10-6-3-7-11-18/h2-13H,14-15H2,1H3,(H,23,24)

SMILES: Cc1cc(c(cc1C(=O)O)OCc1ccccc1)OCc1ccccc1

Synonyms:

• Benzoic Acid, 2-Methyl-4,5-Bis(Phenylmethoxy)-
• 4,5-Bis(benzyloxy)-2-methylbenzoic acid

4,5-Bis(benzyloxy)-2-methylbenzoic acid

CAS: 127531-39-9

Formula: C₂₂H₂₀O₄

Molecular weight: 348.3918

Ref: IN-DA009HSM

4,5-Dibenzyloxy-2-methylbenzoic acid

CAS: 127531-39-9

4,5-Dibenzyloxy-2-methylbenzoic acid

Purity: ≥95%

Molecular weight: 348.39g/mol

Ref: 54-OR345240

4,5-Dibenzyloxy-2-methylbenzoic acid

CAS: 127531-39-9

4,5-Dibenzyloxy-2-methylbenzoic acid (DBMA) is a chemical compound that is known to be an inhibitor of the growth factor receptor. It has been shown to inhibit the growth factor receptor in a dose-dependent manner. DBMA binds to the cytoplasm and inhibits protein synthesis by binding to sequences that are involved in regulating gene expression. This compound also interacts with other proteins including those involved in DNA replication, transcription, and translation. DBMA has been shown to interact with the protein polymerase chain and has been found to bind to the bacterial cells of Salmonella typhimurium.

Formula: C₂₂H₂₀O₄

Purity: Min. 95%

Molecular weight: 348.39 g/mol

Ref: 3D-FD66920