
CAS 127531-42-4
:N-(2-Amino-2-methylpropyl)tetrahydro-3-furancarboxamide
Description:
N-(2-Amino-2-methylpropyl)tetrahydro-3-furancarboxamide, with the CAS number 127531-42-4, is a chemical compound characterized by its unique structure that includes a tetrahydrofuran ring and an amide functional group. This compound features a branched amino group, which contributes to its potential biological activity. It is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being more soluble in polar solvents due to the presence of the amide group. The compound may exhibit properties such as moderate stability under standard conditions, but its reactivity can be influenced by the functional groups present. It is important in medicinal chemistry and may have applications in drug development, particularly in the design of compounds targeting specific biological pathways. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C9H18N2O2
InChI:InChI=1S/C9H18N2O2/c1-9(2,10)6-11-8(12)7-3-4-13-5-7/h7H,3-6,10H2,1-2H3,(H,11,12)
InChI key:InChIKey=XTQAUGFMWMLLAX-UHFFFAOYSA-N
SMILES:C(NCC(C)(C)N)(=O)C1CCOC1
Synonyms:- 3-Furancarboxamide, N-(2-amino-2-methylpropyl)tetrahydro-
- N-(2-Amino-2-methylpropyl)tetrahydro-3-furancarboxamide
- N-(2-Methyl-2-aminopropyl)tetrahydrofuran-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.