CAS 127554-90-9
:4-[[4-[2-[(4-ethyl-3-methyl-5-oxo-2H-pyrrole-1-carbonyl)amino]ethyl]phenyl]sulfonylcarbamoylamino]cyclohexanecarboxylic acid
Description:
The chemical substance known as 4-[[4-[2-[(4-ethyl-3-methyl-5-oxo-2H-pyrrole-1-carbonyl)amino]ethyl]phenyl]sulfonylcarbamoylamino]cyclohexanecarboxylic acid, with the CAS number 127554-90-9, is a complex organic compound characterized by its multi-functional groups and structural intricacies. It features a cyclohexanecarboxylic acid backbone, which contributes to its acidic properties. The presence of sulfonyl and carbamoyl groups indicates potential for strong intermolecular interactions, such as hydrogen bonding, which may influence its solubility and reactivity. Additionally, the pyrrole moiety suggests potential biological activity, as pyrrole derivatives are often associated with various pharmacological effects. The compound's structure implies it may be used in medicinal chemistry, possibly as a lead compound for drug development. Its specific characteristics, such as melting point, solubility, and stability, would depend on the precise molecular interactions and the environment in which it is studied. Overall, this compound exemplifies the complexity often found in pharmaceutical agents, combining multiple functional groups that can interact in diverse ways.
Formula:C24H32N4O7S
InChI:InChI=1/C24H32N4O7S/c1-3-20-15(2)14-28(21(20)29)24(33)25-13-12-16-4-10-19(11-5-16)36(34,35)27-23(32)26-18-8-6-17(7-9-18)22(30)31/h4-5,10-11,17-18H,3,6-9,12-14H2,1-2H3,(H,25,33)(H,30,31)(H2,26,27,32)/t17-,18-
SMILES:CCC1=C(C)CN(C1=O)C(=NCCc1ccc(cc1)S(=O)(=O)NC(=N[C@H]1CC[C@@H](CC1)C(=O)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
trans-Carboxy Glimepiride
CAS:Controlled ProductStability Hygroscopic
Applications An active metabolite of Glimepiride (G410150).
References Groop, L., et al.: Diabetes Care, 15, 737 (1992), Muller, G., et al.: Diabetes, 42, 1852 (1993), Kramer, W., et al.: Biochem. Biophys. Acta, 119, 278 (1994),Formula:C24H32N4O7SColor and Shape:NeatMolecular weight:520.6


