
CAS 127561-11-9
:1H-Indole-3-acetic acid, 5-fluoro-α-oxo-, ethyl ester
Description:
1H-Indole-3-acetic acid, 5-fluoro-α-oxo-, ethyl ester, with the CAS number 127561-11-9, is a synthetic compound that belongs to the class of indole derivatives. This substance is characterized by its indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The presence of a fluoro substituent at the 5-position and an ethyl ester functional group contributes to its unique chemical properties. It is often studied for its potential biological activities, particularly in the context of plant growth regulation and as a potential therapeutic agent. The compound may exhibit auxin-like activity, influencing plant growth and development. Additionally, its structural modifications can affect its solubility, stability, and reactivity, making it a subject of interest in both agricultural and pharmaceutical research. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C12H10FNO3
InChI:InChI=1S/C12H10FNO3/c1-2-17-12(16)11(15)9-6-14-10-4-3-7(13)5-8(9)10/h3-6,14H,2H2,1H3
InChI key:InChIKey=JLGFKONPMDVGBH-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(=O)C=1C=2C(NC1)=CC=C(F)C2
Synonyms:- 1H-Indole-3-acetic acid, 5-fluoro-α-oxo-, ethyl ester
- (5-Fluoro-1H-indol-3-yl)(oxo)acetic acid ethyl ester
- Ethyl 5-fluoro-α-oxo-1H-indole-3-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ethyl 2-(5-fluoro-1H-indol-3-yl)-2-oxoacetate
CAS:Controlled ProductFormula:C12H10FNO3Color and Shape:NeatMolecular weight:235.211
