CAS 127561-17-5
:3-(2-Bromoethyl)-indole
Description:
3-(2-Bromoethyl)-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromoethyl group at the 3-position of the indole ring introduces both halogen and alkyl functionalities, which can influence its reactivity and solubility. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the bromoethyl substituent. It is often used in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity associated with indole derivatives. The bromoethyl group can serve as a reactive site for further chemical modifications, making it a valuable intermediate in various synthetic pathways. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks associated with brominated compounds.
Formula:C10H10BrN
InChI:InChI=1/C10H10BrN/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6H2
SMILES:c1ccc2c(c1)c(CCBr)c[nH]2
Synonyms:- 3-(2-bromoethyl)-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.