CAS 127564-92-5
:Dichloropentafluoropropane
Description:
Dichloropentafluoropropane, with the CAS number 127564-92-5, is a halogenated hydrocarbon characterized by its unique molecular structure, which includes both chlorine and fluorine atoms. This compound typically exhibits a high degree of stability due to the presence of strong carbon-fluorine bonds, making it resistant to degradation. It is a colorless gas or liquid at room temperature, depending on its specific formulation and conditions. Dichloropentafluoropropane is known for its low toxicity and is often utilized in various industrial applications, including as a refrigerant or solvent. Its physical properties include a relatively low boiling point and high density compared to other hydrocarbons. Additionally, the compound's environmental impact is a consideration, as halogenated compounds can contribute to ozone depletion and have greenhouse gas potential. Proper handling and storage are essential to mitigate any risks associated with its use. Overall, dichloropentafluoropropane is a significant compound in the realm of synthetic chemistry and industrial applications.
Formula:C3HCl2F5
InChI:InChI=1/C3HCl2F5/c4-1(2(5,6)7)3(8,9)10/h1H
SMILES:C(C(Cl)(F)F)(C(F)(F)F)Cl
Synonyms:- 3,3-Dichloro-1,1,1,2,2-Pentafluoropropane
- Dichloropentafluoropropane
- Freon 225
- Hcfc-225
- Hcfc-225 (Mixture Of Ca And Cb)
- Hcfc-225Da
- Propane, dichloropentafluoro-
- R 225
- R 225 (fluorocarbon)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
