CAS 127566-18-1
:6-Chloro-3-imino-2,3-dihydropyridazine-2-acetic acid
Description:
6-Chloro-3-imino-2,3-dihydropyridazine-2-acetic acid, identified by its CAS number 127566-18-1, is a chemical compound that belongs to the class of pyridazine derivatives. This substance features a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at adjacent positions. The presence of a chloro substituent at the 6-position and an imino group at the 3-position contributes to its unique reactivity and potential biological activity. The acetic acid moiety indicates that it possesses acidic properties, which may influence its solubility and interaction with biological systems. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its pharmacodynamics, toxicity, and therapeutic efficacy would be necessary to fully understand its potential uses. As with any chemical substance, proper handling and safety measures should be observed due to its potential biological effects.
Formula:C6H6ClN3O2
InChI:InChI=1/C6H6ClN3O2/c7-4-1-2-5(8)10(9-4)3-6(11)12/h1-2,8H,3H2,(H,11,12)
SMILES:c1cc(=N)n(CC(=O)O)nc1Cl
Synonyms:- (3-Chloro-6-imino-1(6H)-pyridazinyl)acetic acid
- 1(6H)-pyridazineacetic acid, 3-chloro-6-imino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
