CAS 127566-19-2

2-Chloroimidazo[1,2-b]pyridazine

Description:

2-Chloroimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, with a chlorine substituent at the second position of the imidazole ring. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the chlorine atom can influence its reactivity and solubility, often enhancing its lipophilicity. The compound's structure allows for various interactions with biological targets, which may include enzyme inhibition or receptor modulation. Its synthesis generally involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. As with many heterocycles, it may exhibit interesting electronic properties, making it a candidate for further research in fields such as agrochemicals or pharmaceuticals. Safety and handling precautions should be observed due to its potential biological activity and chemical reactivity.

Formula: C₆H₄ClN₃

InChI: InChI=1S/C6H4ClN3/c7-5-4-10-6(9-5)2-1-3-8-10/h1-4H

InChI key: InChIKey=HQHPYERNFAFRRI-UHFFFAOYSA-N

SMILES: ClC=1N=C2N(C1)N=CC=C2

Synonyms:

• Imidazo[1,2-b]pyridazine, 2-chloro-
• 2-Chloroimidazo[1,2-b]pyridazine

2-CHLOROIMIDAZO[1,2-B]PYRIDAZINE

CAS: 127566-19-2

Formula: C₆H₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.5691

Ref: IN-DA00A79I

2-Chloroimidazo[1,2-b]pyridazine

CAS: 127566-19-2

Purity: 98+%

Molecular weight: 153.5700073

Ref: 10-F760855