CymitQuimica logo

CAS 127582-36-9

:

Benzenemethanaminium, N,N,N-trimethyl-, fluoride, hydrate (1:1:?)

Description:
Benzenemethanaminium, N,N,N-trimethyl-, fluoride, hydrate (1:1:?) is a quaternary ammonium compound characterized by its trimethylated amine structure, which contributes to its cationic nature. The presence of the fluoride ion indicates that it can act as a source of fluoride, potentially influencing its reactivity and solubility in various solvents. As a hydrate, it contains water molecules in its crystalline structure, which can affect its stability and solubility properties. This compound is typically used in various applications, including as a surfactant or in organic synthesis. Its quaternary ammonium structure often imparts antimicrobial properties, making it relevant in biocidal formulations. The specific interactions of this compound with biological systems or materials can vary based on its concentration and the presence of other substances. Overall, its unique combination of a benzyl group, trimethylammonium moiety, and fluoride ion makes it a compound of interest in both industrial and research settings.
Formula:C10H16N·F·xH2O
InChI:InChI=1S/C10H16N.FH.H2O/c1-11(2,3)9-10-7-5-4-6-8-10;;/h4-8H,9H2,1-3H3;1H;1H2/q+1;;/p-1
InChI key:InChIKey=RQVPEOYSZICMEA-UHFFFAOYSA-M
SMILES:C([N+](C)(C)C)C1=CC=CC=C1.[F-].O
Synonyms:
  • Benzenemethanaminium, N,N,N-trimethyl-, fluoride, hydrate
  • Benzenemethanaminium, N,N,N-trimethyl-, fluoride, hydrate (1:1:?)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.