CAS 127582-76-7
:Fmoc-7-amino-heptanoic acid
Description:
Fmoc-7-amino-heptanoic acid is a synthetic amino acid derivative characterized by the presence of a 7-carbon aliphatic chain and a fluorenylmethyloxycarbonyl (Fmoc) protecting group. The Fmoc group is commonly used in peptide synthesis to protect the amino group, allowing for selective reactions at the carboxylic acid end. This compound features a primary amine at one end and a carboxylic acid at the other, making it a bifunctional molecule suitable for coupling reactions in peptide synthesis. Its structure contributes to its hydrophobic properties, which can influence the solubility and stability of peptides formed with it. The CAS number 127582-76-7 uniquely identifies this compound in chemical databases, facilitating its recognition in research and industrial applications. Fmoc-7-amino-heptanoic acid is often utilized in the development of peptide-based therapeutics and in the study of structure-activity relationships in medicinal chemistry. Its characteristics make it a valuable building block in the synthesis of various bioactive peptides.
Formula:C22H25NO4
InChI:InChI=1/C22H25NO4/c24-21(25)13-3-1-2-8-14-23-22(26)27-15-20-18-11-6-4-9-16(18)17-10-5-7-12-19(17)20/h4-7,9-12,20H,1-3,8,13-15H2,(H,23,26)(H,24,25)
SMILES:C(CCCN=C(O)OCC1c2ccccc2c2ccccc12)CCC(=O)O
Synonyms:- 7-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}heptanoic acid
- Fmoc-7-Ahp-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Fmoc-7-aminoheptanoic acid
CAS:<p>Bachem ID: 4042197.</p>Formula:C22H25NO4Purity:99.77%Color and Shape:White PowderMolecular weight:367.45Heptanoic acid, 7-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
CAS:Formula:C22H25NO4Purity:98%Color and Shape:SolidMolecular weight:367.43827-Aminoheptanoic acid, N-FMOC protected
CAS:7-Aminoheptanoic acid, N-FMOC protectedPurity:97%Color and Shape:White PowderMolecular weight:367.4382g/mol7-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)heptanoic acid
CAS:Formula:C22H25NO4Purity:98%Color and Shape:SolidMolecular weight:367.445Fmoc-7-amino-heptanoic acid
CAS:<p>Fmoc-7-amino-heptanoic acid: used for PROTAC linker synthesis, has Fmoc-protected amine and carboxylic ends for conjugation reactions.</p>Formula:C22H25NO4Color and Shape:SolidMolecular weight:367.44





