CAS 127592-29-4
:(1R,2S,3R,4S)-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol
Description:
(1R,2S,3R,4S)-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol is a polycyclic aromatic compound characterized by its complex structure, which includes multiple fused aromatic rings and hydroxyl functional groups. This compound is a stereoisomer, indicating that it has specific spatial arrangements of its atoms, which can significantly influence its chemical behavior and biological activity. The presence of four hydroxyl groups contributes to its potential solubility in polar solvents and may enhance its reactivity, particularly in redox reactions. Additionally, the stereochemistry of the molecule can affect its interactions with biological systems, making it of interest in pharmacological studies. Its unique structure may also impart specific optical properties, which can be explored in various applications, including materials science and organic electronics. Overall, (1R,2S,3R,4S)-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol represents a fascinating subject for research in both synthetic chemistry and potential therapeutic applications.
Formula:C18H16O4
InChI:InChI=1/C18H16O4/c19-15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16(20)18(22)17(15)21/h1-8,15-22H/t15-,16+,17+,18-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(1α,2β,3β,4α)-1,2,3,4-Tetrahydro-1,2,3,4-chrysenetetrol-d6
CAS:Controlled ProductFormula:C18D6H10O4Color and Shape:NeatMolecular weight:302.354(1α,2β,3β,4α)-1,2,3,4-Tetrahydro-1,2,3,4-chrysenetetrol
CAS:Controlled ProductFormula:C18H16O4Color and Shape:NeatMolecular weight:296.317
