CAS 127598-66-7
:4-Fluoro-N-(4-methylphenyl)benzenemethanamine
Description:
4-Fluoro-N-(4-methylphenyl)benzenemethanamine, also known by its CAS number 127598-66-7, is an organic compound characterized by its aromatic structure and the presence of a fluorine atom and an amine group. This compound features a fluorobenzene moiety, which contributes to its potential reactivity and interaction with biological systems. The presence of the N-(4-methylphenyl) group indicates that it has a substituted aniline structure, which can influence its solubility and polarity. Typically, compounds of this nature may exhibit properties such as moderate to high melting points and solubility in organic solvents, depending on their specific functional groups. Additionally, the fluorine substitution can enhance lipophilicity and may affect the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Safety and handling precautions are essential, as with many amines and fluorinated compounds, due to potential toxicity and environmental impact. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis.
Formula:C14H14FN
InChI:InChI=1S/C14H14FN/c1-11-2-8-14(9-3-11)16-10-12-4-6-13(15)7-5-12/h2-9,16H,10H2,1H3
InChI key:InChIKey=SFWHBAZHARGIHE-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C)C=C1)C2=CC=C(F)C=C2
Synonyms:- 4-Fluoro-N-(4-methylphenyl)benzenemethanamine
- N-(4-Fluorophenylmethyl)-4-methylbenzenamine
- Benzenemethanamine, 4-fluoro-N-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
