CAS 127600-13-9
:5,5-DIMETHYL-2-(3'-FORMYLPROPYL)-1,3-DIOXANE
Description:
5,5-Dimethyl-2-(3'-formylpropyl)-1,3-dioxane is an organic compound characterized by its dioxane ring structure, which features two ether linkages and a carbonyl group. The presence of the dimethyl groups at the 5-position contributes to its steric hindrance and influences its reactivity and solubility. The 3'-formylpropyl substituent introduces an aldehyde functional group, which can participate in various chemical reactions, such as condensation and nucleophilic addition. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of more complex molecules or as intermediates in pharmaceutical chemistry. The dioxane moiety may also impart certain stability and solubility characteristics, making it of interest in various chemical processes. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H18O3
InChI:InChI=1/C10H18O3/c1-10(2)7-12-9(13-8-10)5-3-4-6-11/h6,9H,3-5,7-8H2,1-2H3
SMILES:CC1(C)COC(CCCC=O)OC1
Synonyms:- 4-(5,5-Dimethyl-1,3-Dioxan-2-Yl)Butyraldehyde
- (5,5-Dimethyl-1,3-Dioxan-2-Yl)Butanal
- 5,5-Dimethyl-2-Butanal-1,3-Dioxane
- 5,5-Dimethyl-1,3-dioxane-2-butanal, 97%
- 4-(5,5-Dimethyl-1,3-Dioxan-2-Yl)Butanal
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5,5-Dimethyl-1,3-dioxane-2-butanal, 96%
CAS:It is employed as a intermediate for pharmaceuticals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not c
Formula:C10H18O3Purity:96%Color and Shape:Liquid, Clear colorlessMolecular weight:186.25

