CymitQuimica logo

CAS 1276125-31-5

:

Phenylmethyl 3-amino-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate

Description:
Phenylmethyl 3-amino-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate, identified by its CAS number 1276125-31-5, is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrole and pyrazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include anti-inflammatory or anticancer effects, although specific biological data may vary. The presence of the amino group and the carboxylate functionality suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its solubility and stability can depend on the solvent and environmental conditions, making it relevant for various applications in medicinal chemistry and drug development. As with many organic compounds, safety and handling precautions are essential, given the potential for toxicity or reactivity. Further research is often necessary to fully elucidate its pharmacological properties and potential applications in therapeutic contexts.
Formula:C13H14N4O2
InChI:InChI=1S/C13H14N4O2/c14-12-10-6-17(7-11(10)15-16-12)13(18)19-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H3,14,15,16)
InChI key:InChIKey=NTDOIOXSOPOSEQ-UHFFFAOYSA-N
SMILES:NC=1C2=C(CN(C(OCC3=CC=CC=C3)=O)C2)NN1
Synonyms:
  • Pyrrolo[3,4-c]pyrazole-5(1H)-carboxylic acid, 3-amino-4,6-dihydro-, phenylmethyl ester
  • Phenylmethyl 3-amino-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.