CAS 1276197-23-9

Description:

The chemical substance with the CAS number 1276197-23-9 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties, including molecular weight, solubility, boiling and melting points, and reactivity, which are determined by their molecular structure and functional groups. Such substances may be used in various applications, including pharmaceuticals, agrochemicals, or materials science, depending on their chemical nature. To obtain precise characteristics, including safety data, handling procedures, and potential applications, it is advisable to consult specialized chemical databases, scientific literature, or safety data sheets (SDS) that provide comprehensive information about the specific compound in question.

Formula: C₁₇H₁₃ClD₆N₂S·C₂H₂O₄

InChI: InChI=1S/C17H19ClN2S.C2H2O4/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20;3-1(4)2(5)6/h3-4,6-9,12H,5,10-11H2,1-2H3;(H,3,4)(H,5,6)/i1D3,2D3;

InChI key: InChIKey=FZNQRUYAXGKACN-TXHXQZCNSA-N

SMILES: C(CCN(C([2H])([2H])[2H])C([2H])([2H])[2H])N1C=2C(SC=3C1=CC=CC3)=CC=C(Cl)C2.C(C(O)=O)(O)=O

Chlorpromazine-d6 Oxalate(N,N-dimethyl-d6)

CAS: 1276197-23-9

Purity: 99 atom % D

Color and Shape: Off White Solid

Molecular weight: 414.94

Ref: 3U-D7326

Chlorpromazine-d6 Oxalate (N,N-dimethyl-d6)

Controlled Product

CAS: 1276197-23-9

Applications Chlorpromazine-d6 Oxalate (N,N-dimethyl-d6) (CAS# 1276197-23-9) is a useful isotopically labeled research compound.

Formula: C₁₇D₆H₁₃ClN₂S·C₂H₂O₄

Color and Shape: Off-White

Molecular weight: 414.93

Ref: TR-C211376