CAS 1276197-41-1

6-Nitrobenzen-2,4-d2-amine

Description:

6-Nitrobenzen-2,4-d2-amine is a chemical compound characterized by the presence of a nitro group (-NO2) and an amine group (-NH2) attached to a benzene ring. The designation "2,4-d2" indicates that the compound contains deuterium (D), a stable isotope of hydrogen, at the 2 and 4 positions of the benzene ring, which can influence its physical and chemical properties, such as stability and reactivity. The nitro group is known for its electron-withdrawing properties, which can affect the compound's acidity and nucleophilicity. This compound may be utilized in various applications, including organic synthesis and as a potential intermediate in the production of pharmaceuticals or agrochemicals. Its unique isotopic labeling can also make it valuable in studies involving reaction mechanisms or metabolic pathways. As with many nitro compounds, it may exhibit specific safety and handling considerations due to potential toxicity or environmental impact.

Formula: C₆H₄D₂N₂O₂

InChI: InChI=1S/C6H6N2O2/c7-5-3-1-2-4-6(5)8(9)10/h1-4H,7H2/i2D,3D

InChI key: InChIKey=DPJCXCZTLWNFOH-PBNXXWCMSA-N

SMILES: N(=O)(=O)C1=C(N)C(=CC(=C1)[2H])[2H]

Synonyms:

• 6-Nitrobenzen-2,4-d2-amine
• Benzen-2,4-d2-amine, 6-nitro-

2-Nitroaniline-4,6-d2

CAS: 1276197-41-1

Purity: 99 atom % D

Color and Shape: Orange Solid

Molecular weight: 140.14

Ref: 3U-D7284

2-Nitroaniline-4,6-d2

Controlled Product

CAS: 1276197-41-1

Applications 2-Nitroaniline-4,6-d2 (CAS# 1276197-41-1) is a useful isotopically labeled research compound.

Formula: C₆H₄D₂N₂O₂

Color and Shape: Neat

Molecular weight: 140.14

Ref: TR-N491777