CAS 127626-07-7
:3-(1,2,3,6-Tetrahydro-4-pyridinyl)-1H-indol-5-ol
Description:
3-(1,2,3,6-Tetrahydro-4-pyridinyl)-1H-indol-5-ol, identified by its CAS number 127626-07-7, is a chemical compound that features a complex structure combining an indole moiety with a tetrahydropyridine ring. This compound is characterized by its potential biological activity, particularly in the context of pharmacology, where it may exhibit properties relevant to neuropharmacology or other therapeutic areas. The presence of both the indole and pyridine functionalities suggests that it may engage in various interactions with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. The hydroxyl group on the indole ring can contribute to its solubility and reactivity, making it a candidate for further investigation in medicinal chemistry. Additionally, the stereochemistry of the tetrahydropyridine ring may play a crucial role in its biological activity, affecting how the compound interacts with receptors or enzymes. Overall, this compound represents a fascinating subject for research due to its structural complexity and potential applications in drug development.
Formula:C13H14N2O
InChI:InChI=1S/C13H14N2O/c16-10-1-2-13-11(7-10)12(8-15-13)9-3-5-14-6-4-9/h1-3,7-8,14-16H,4-6H2
InChI key:InChIKey=YMCFWPXQTPNUBN-UHFFFAOYSA-N
SMILES:OC=1C=C2C(=CNC2=CC1)C=3CCNCC3
Synonyms:- 1H-Indol-5-ol, 3-(1,2,3,6-tetrahydro-4-pyridinyl)-
- 3-(1,2,3,6-Tetrahydro-4-pyridinyl)-1H-indol-5-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
