CAS 127627-50-3
:2-carbomethoxy-3-(4-fluorophenyl)-N-propylnortropane
Description:
2-Carbomethoxy-3-(4-fluorophenyl)-N-propylnortropane, identified by its CAS number 127627-50-3, is a synthetic compound that belongs to the class of tropane derivatives. This substance features a tropane ring structure, which is a bicyclic compound known for its presence in various alkaloids. The presence of a carbomethoxy group and a 4-fluorophenyl substituent contributes to its unique chemical properties and potential biological activity. The N-propyl group indicates that there is a propyl chain attached to the nitrogen atom of the tropane structure, which can influence the compound's pharmacological profile. Compounds of this nature are often studied for their potential effects on the central nervous system, particularly in relation to dopamine transport and receptor interactions. However, detailed studies on its specific biological activity, toxicity, and therapeutic potential may be limited, necessitating further research to fully understand its characteristics and applications in medicinal chemistry.
Formula:C18H24FNO2
InChI:InChI=1/C18H24FNO2/c1-3-10-20-14-8-9-16(20)17(18(21)22-2)15(11-14)12-4-6-13(19)7-5-12/h4-7,14-17H,3,8-11H2,1-2H3/t14?,15?,16-,17?/m1/s1
SMILES:CCCN1C2CC[C@@H]1C(C(C2)c1ccc(cc1)F)C(=O)OC
Synonyms:- 2-Cfppn
- methyl (1R)-3-(4-fluorophenyl)-8-propyl-8-azabicyclo[3.2.1]octane-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-Azabicyclo[3.2.1]octane-2-carboxylic acid, 3-(4-fluorophenyl)-8-propyl-, methyl ester, [1R-(exo,exo)]- (9CI)
CAS:Formula:C18H24FNO2Molecular weight:305.3871
