CAS 127648-29-7
:8-AZABICYCLO(3.2.1)OCTANE-2-CARBOXYLIC ACID, 3-(4-FLUOROPHENYL)-8-(2-PROPENYL)-, METHYL ESTER, (R-(EXO, EXO))-
Description:
8-Azabicyclo(3.2.1)octane-2-carboxylic acid, 3-(4-fluorophenyl)-8-(2-propenyl)-, methyl ester, with CAS number 127648-29-7, is a complex organic compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring system. This compound features a carboxylic acid functional group, which is esterified with methanol, resulting in a methyl ester. The presence of a 4-fluorophenyl group and a propenyl substituent contributes to its unique chemical properties and potential biological activity. The stereochemistry is specified as (R-(exo, exo)), indicating a particular spatial arrangement of its substituents that may influence its reactivity and interactions with biological targets. Such compounds are often studied for their potential pharmacological applications, particularly in medicinal chemistry, due to their structural complexity and the presence of functional groups that can participate in various chemical reactions. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity in organic chemistry.
Formula:C18H22FNO2
InChI:InChI=1/C18H22FNO2/c1-3-10-20-14-8-9-16(20)17(18(21)22-2)15(11-14)12-4-6-13(19)7-5-12/h3-7,14-17H,1,8-11H2,2H3/t14-,15+,16+,17-/m0/s1
Synonyms:- 2-carbomethoxy-3-(4-fluorophenyl)-N-allylnortropane
- methyl (1R,2S,3S,5S)-3-(4-fluorophenyl)-8-(prop-2-en-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-Azabicyclo[3.2.1]octane-2-carboxylic acid, 3-(4-fluorophenyl)-8-(2-propen-1-yl)-, methyl ester, (1R,2S,3S,5S)-
CAS:Formula:C18H22FNO2Molecular weight:303.3712
