CAS 127649-10-9
:1-(2,2,2-trifluoroethoxysulfonyl)ethane
Description:
1-(2,2,2-Trifluoroethoxysulfonyl)ethane, with the CAS number 127649-10-9, is a chemical compound characterized by the presence of a sulfonyl group attached to an ethane backbone, along with a trifluoroethoxy substituent. This compound features a sulfonyl functional group, which is known for its strong electron-withdrawing properties, enhancing the reactivity of the molecule. The trifluoroethoxy group contributes to the compound's hydrophobic characteristics and can influence its solubility and volatility. Typically, compounds like this may exhibit stability under various conditions but can be sensitive to hydrolysis, especially in the presence of nucleophiles. The trifluoromethyl groups often impart unique electronic properties, making such compounds of interest in medicinal chemistry and materials science. Additionally, the presence of fluorine atoms can enhance the lipophilicity of the molecule, potentially affecting its biological activity and interaction with other substances. Overall, 1-(2,2,2-trifluoroethoxysulfonyl)ethane is a specialized compound with applications that may include pharmaceuticals and agrochemicals.
Formula:C4H7F3O3S
InChI:InChI=1/C4H7F3O3S/c1-2-11(8,9)10-3-4(5,6)7/h2-3H2,1H3
SMILES:CCS(=O)(=O)OCC(F)(F)F
Synonyms:- 2,2,2-Trifluoroethyl ester ethanesulfonic acid
- 2,2,2-Trifluoroethyl Ethanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
