CAS 127652-85-1
:2-BROMO-3-CYCLOHEXYL-PROP-2-EN-1-OL
Description:
2-Bromo-3-cyclohexyl-prop-2-en-1-ol is an organic compound characterized by its unique structure, which includes a bromine atom, a cyclohexyl group, and an allylic alcohol functional group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, such as nucleophilic substitution reactions. The cyclohexyl group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with other substances. The prop-2-en-1-ol moiety indicates that it has a double bond, which can participate in addition reactions, further enhancing its reactivity profile. This compound may exhibit interesting biological activities due to its structural features, making it of interest in medicinal chemistry and synthetic organic chemistry. Additionally, its physical properties, such as boiling point and melting point, would be influenced by the molecular weight and the presence of functional groups, which are critical for applications in various chemical processes. Overall, 2-bromo-3-cyclohexyl-prop-2-en-1-ol is a versatile compound with potential applications in both research and industry.
Formula:C9H15BrO
InChI:InChI=1/C9H15BrO/c10-9(7-11)6-8-4-2-1-3-5-8/h6,8,11H,1-5,7H2/b9-6-
Synonyms:- (2Z)-2-bromo-3-cyclohexylprop-2-en-1-ol
- 2-Bromo-3-cyclohexyl-prop-2-en-1-ol
- 2-Propen-1-ol, 2-bromo-3-cyclohexyl-, (E)- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.