CAS 127654-03-9
:(6Z)-6-(6-methyl-5-oxo-5,6-dihydro-11H-pyrido[4,3-c][1]benzazepin-11-ylidene)hexanoic acid
Description:
The chemical substance known as (6Z)-6-(6-methyl-5-oxo-5,6-dihydro-11H-pyrido[4,3-c][1]benzazepin-11-ylidene)hexanoic acid, with the CAS number 127654-03-9, is characterized by its complex molecular structure, which includes a pyrido-benzazepine core and a hexanoic acid moiety. This compound features a conjugated system that may contribute to its potential biological activity, possibly influencing its interactions with various biological targets. The presence of the 6-methyl and 5-oxo groups suggests that it may exhibit specific reactivity or stability under certain conditions. Its structural features indicate that it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of functional groups. Overall, this substance represents a unique chemical entity that may have implications in drug discovery and development, warranting further investigation into its pharmacological properties and potential applications.
Formula:C20H20N2O3
InChI:InChI=1/C20H20N2O3/c1-22-18-9-6-5-8-15(18)14(7-3-2-4-10-19(23)24)17-13-21-12-11-16(17)20(22)25/h5-9,11-13H,2-4,10H2,1H3,(H,23,24)/b14-7-
SMILES:Cn1c2ccccc2/c(=C/CCCCC(=O)O)/c2cnccc2c1=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
KF 13218
CAS:KF 13218 is a selective, potent and long lasting thromboxane B2 (TXB2) synthase inhibitor with an IC50 value of 5.3±1.3 nM.Formula:C20H20N2O3Purity:98%Color and Shape:SolidMolecular weight:336.38KF 13218
CAS:KF 13218 is a research tool that is used as an activator to study the effects of ion channels on cell function. It binds to receptor sites and regulates the flow of ions through ion channels, which are protein structures that allow the passage of charged particles. KF 13218 has an affinity for ligand-gated ion channels, such as nicotinic acetylcholine receptors and serotonin 5HT3 receptors. This drug also has been shown to inhibit the activity of potassium channels in human neutrophils.
Formula:C20H20N2O3Purity:Min. 95%Molecular weight:336.4 g/mol

