CAS 127654-03-9

(6Z)-6-(6-methyl-5-oxo-5,6-dihydro-11H-pyrido[4,3-c][1]benzazepin-11-ylidene)hexanoic acid

Description:

The chemical substance known as (6Z)-6-(6-methyl-5-oxo-5,6-dihydro-11H-pyrido[4,3-c][1]benzazepin-11-ylidene)hexanoic acid, with the CAS number 127654-03-9, is characterized by its complex molecular structure, which includes a pyrido-benzazepine core and a hexanoic acid moiety. This compound features a conjugated system that may contribute to its potential biological activity, possibly influencing its interactions with various biological targets. The presence of the 6-methyl and 5-oxo groups suggests that it may exhibit specific reactivity or stability under certain conditions. Its structural features indicate that it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of functional groups. Overall, this substance represents a unique chemical entity that may have implications in drug discovery and development, warranting further investigation into its pharmacological properties and potential applications.

Formula: C₂₀H₂₀N₂O₃

InChI: InChI=1/C20H20N2O3/c1-22-18-9-6-5-8-15(18)14(7-3-2-4-10-19(23)24)17-13-21-12-11-16(17)20(22)25/h5-9,11-13H,2-4,10H2,1H3,(H,23,24)/b14-7-

SMILES: Cn1c2ccccc2/c(=C/CCCCC(=O)O)/c2cnccc2c1=O

KF 13218

CAS: 127654-03-9

KF 13218 is a research tool that is used as an activator to study the effects of ion channels on cell function. It binds to receptor sites and regulates the flow of ions through ion channels, which are protein structures that allow the passage of charged particles. KF 13218 has an affinity for ligand-gated ion channels, such as nicotinic acetylcholine receptors and serotonin 5HT3 receptors. This drug also has been shown to inhibit the activity of potassium channels in human neutrophils.

Formula: C₂₀H₂₀N₂O₃

Purity: Min. 95%

Molecular weight: 336.4 g/mol

Ref: 3D-CFA65403

KF 13218

CAS: 127654-03-9

KF 13218 is a selective, potent and long lasting thromboxane B2 (TXB2) synthase inhibitor with an IC50 value of 5.3±1.3 nM.

Formula: C₂₀H₂₀N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 336.38

Ref: TM-T11755