CAS 1276666-15-9
:5-Chloro-2-[(5S)-hexahydro-5-methyl-1H-1,4-diazepin-1-yl]benzoxazole
Description:
5-Chloro-2-[(5S)-hexahydro-5-methyl-1H-1,4-diazepin-1-yl]benzoxazole is a chemical compound characterized by its complex structure, which includes a benzoxazole ring and a hexahydro-1,4-diazepine moiety. The presence of a chlorine atom at the 5-position of the benzoxazole contributes to its reactivity and potential biological activity. The hexahydro-5-methyl-1H-1,4-diazepin structure indicates that it contains a saturated nitrogen-containing heterocyclic ring, which may influence its pharmacological properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific interactions, solubility, and stability would depend on the functional groups present and the overall molecular conformation. Additionally, the stereochemistry indicated by the (5S) designation suggests that the compound has specific spatial arrangements that could affect its biological interactions and efficacy. Overall, this compound represents a unique combination of structural features that may be explored for therapeutic applications.
Formula:C13H16ClN3O
InChI:InChI=1S/C13H16ClN3O/c1-9-4-6-17(7-5-15-9)13-16-11-8-10(14)2-3-12(11)18-13/h2-3,8-9,15H,4-7H2,1H3/t9-/m0/s1
InChI key:InChIKey=RADJSLVGESASMK-VIFPVBQESA-N
SMILES:C[C@H]1CCN(C=2OC=3C(N2)=CC(Cl)=CC3)CCN1
Synonyms:- Benzoxazole, 5-chloro-2-[(5S)-hexahydro-5-methyl-1H-1,4-diazepin-1-yl]-
- 5-Chloro-2-[(5S)-hexahydro-5-methyl-1H-1,4-diazepin-1-yl]benzoxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
