CAS 127667-00-9

2-chloro-5-methoxybenzonitrile

Description:

2-Chloro-5-methoxybenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, a methoxy group, and a nitrile group. The presence of the chloro substituent at the 2-position and the methoxy group at the 5-position on the benzene ring contributes to its unique chemical properties, influencing its reactivity and solubility. The nitrile group (-C≡N) is known for its polar nature, which can enhance the compound's solubility in polar solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-chloro-5-methoxybenzonitrile is a valuable compound in synthetic organic chemistry with specific functional groups that dictate its chemical behavior.

Formula: C₈H₆ClNO

InChI: InChI=1/C8H6ClNO/c1-11-7-2-3-8(9)6(4-7)5-10/h2-4H,1H3

SMILES: COc1ccc(c(c1)C#N)Cl

Synonyms:

• Benzonitrile, 2-Chloro-5-Methoxy-

Benzonitrile, 2-chloro-5-methoxy-

CAS: 127667-00-9

Formula: C₈H₆ClNO

Purity: 96%

Color and Shape: Solid

Molecular weight: 167.5923

Ref: IN-DA000X9E

2-Chloro-5-methoxybenzonitrile

CAS: 127667-00-9

2-Chloro-5-methoxybenzonitrile

Purity: 98%

Molecular weight: 167.59g/mol

Ref: 54-OR301005

2-Chloro-5-methoxybenzonitrile

CAS: 127667-00-9

2-Chloro-5-methoxybenzonitrile is an organic compound that has a chlorinated methoxy group and a cyano group. It is synthesized by the reaction of 2-chloro-5-hydroxybenzonitrile with sulfuryl chloride in the presence of potassium carbonate. The yield of this reaction can be increased by adding a chlorinated solvent such as dichloromethane or chloroform. 2-Chloro-5-methoxybenzonitrile is used in the synthesis of various drugs and other organic compounds, such as amides and benzene ring compounds.

Formula: C₈H₆ClNO

Color and Shape: Powder

Molecular weight: 167.59 g/mol

Ref: 3D-FC70696

2-Chloro-5-methoxybenzonitrile

CAS: 127667-00-9

Formula: C₈H₆ClNO

Purity: 96%

Color and Shape: No data available.

Molecular weight: 167.59

Ref: 10-F237371