CAS 127667-01-0
:2-Fluoro-5-methoxybenzonitrile
Description:
2-Fluoro-5-methoxybenzonitrile is an organic compound characterized by the presence of a fluorine atom and a methoxy group attached to a benzene ring, along with a nitrile functional group. Its molecular structure consists of a benzene ring substituted at the 2-position with a fluorine atom and at the 5-position with a methoxy group (-OCH3), while the nitrile group (-C≡N) is typically attached to the benzene ring. This compound is likely to exhibit properties such as moderate polarity due to the presence of the electronegative fluorine and the methoxy group, which can influence its solubility in various solvents. The nitrile group contributes to its reactivity, making it a potential candidate for further chemical transformations. Additionally, 2-Fluoro-5-methoxybenzonitrile may have applications in pharmaceuticals or agrochemicals, given the significance of fluorinated compounds in medicinal chemistry. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases.
Formula:C8H6FNO
InChI:InChI=1S/C8H6FNO/c1-11-7-2-3-8(9)6(4-7)5-10/h2-4H,1H3
InChI key:InChIKey=VBZLRHYLNXWZIU-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(OC)=CC=C1F
Synonyms:- 2-Fluoro-5-(methyloxy)benzonitrile
- 2-Fluoro-5-methoxybenzonitrile
- Benzonitrile, 2-fluoro-5-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Fluoro-5-methoxybenzonitrile
CAS:Formula:C8H6FNOPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:151.142-Fluoro-5-methoxybenzonitrile, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H6FNOPurity:98%Color and Shape:Crystals or powder or crystalline powder, White to pale creamMolecular weight:151.14Benzonitrile, 2-fluoro-5-methoxy-
CAS:Formula:C8H6FNOPurity:97%Color and Shape:SolidMolecular weight:151.13772-Fluoro-5-methoxybenzonitrile
CAS:2-Fluoro-5-methoxybenzonitrileFormula:C8H6FNOPurity:98%Color and Shape: white solidMolecular weight:151.14g/mol2-Fluoro-5-methoxybenzonitrile
CAS:<p>2-Fluoro-5-methoxybenzonitrile is a metal catalyst that has been shown to be effective in the synthesis of various organic compounds. The use of ultrasound can increase the yields of reactions involving 2-fluoro-5-methoxybenzonitrile. 2-Fluoro-5-methoxybenzonitrile has also been demonstrated as a pharmacological agent with a number of potential applications. It inhibits the activity of phosphodiesterase 4, which may lead to an improved therapeutic profile for conditions such as asthma and erectile dysfunction. 2-Fluoro-5-methoxybenzonitrile is also used in photochemical reactions, where it acts as an inhibitor to prevent the formation of undesired products.</p>Formula:C8H6FNOPurity:Min. 95%Color and Shape:PowderMolecular weight:151.14 g/mol2-Fluoro-5-methoxybenzonitrile
CAS:Formula:C8H6FNOPurity:98%Color and Shape:SolidMolecular weight:151.14





