CymitQuimica logo

CAS 127667-18-9

:

α-(4-Chlorophenyl)-2-cyanobenzeneacetonitrile

Description:
α-(4-Chlorophenyl)-2-cyanobenzeneacetonitrile, identified by its CAS number 127667-18-9, is an organic compound characterized by its complex structure, which includes a cyano group and a chlorophenyl moiety. This compound typically appears as a crystalline solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique chemical properties. The presence of the cyano group contributes to its reactivity, making it a useful intermediate in various synthetic pathways. Additionally, the chlorophenyl group can influence the compound's electronic properties and solubility, affecting its behavior in different chemical environments. The compound's stability and reactivity can vary based on factors such as temperature and solvent, which are important considerations in its handling and application. Overall, α-(4-Chlorophenyl)-2-cyanobenzeneacetonitrile is a significant compound in organic synthesis, with implications in medicinal chemistry and material science.
Formula:C15H9ClN2
InChI:InChI=1S/C15H9ClN2/c16-13-7-5-11(6-8-13)15(10-18)14-4-2-1-3-12(14)9-17/h1-8,15H
InChI key:InChIKey=NLYDHCDZKHWMOB-UHFFFAOYSA-N
SMILES:C(C#N)(C1=C(C#N)C=CC=C1)C2=CC=C(Cl)C=C2
Synonyms:
  • Benzeneacetonitrile, α-(4-chlorophenyl)-2-cyano-
  • α-(4-Chlorophenyl)-2-cyanobenzeneacetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.