CAS 127675-46-1

3-Chloro-2,4-difluorobenzaldehyde

Description:

3-Chloro-2,4-difluorobenzaldehyde is an aromatic aldehyde characterized by the presence of a benzene ring substituted with a chlorine atom and two fluorine atoms at specific positions, along with an aldehyde functional group. This compound typically exhibits a pale yellow to light brown appearance and is known for its distinctive aromatic odor. The presence of electronegative halogen atoms, such as chlorine and fluorine, influences its reactivity and polarity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure contributes to its potential applications in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition. Additionally, the compound's physical properties, such as boiling point and solubility, are influenced by the substituents on the benzene ring. Safety precautions should be observed when handling this substance, as it may pose health risks due to its reactive nature and potential toxicity.

Formula: C₇H₃ClF₂O

InChI: InChI=1/C7H3ClF2O/c8-6-5(9)2-1-4(3-11)7(6)10/h1-3H

SMILES: c1cc(c(c(c1C=O)F)Cl)F

Synonyms:

• 1-[2-(Trifluoromethyl)Phenyl]Ethanamine
• 3-CHLORO-2,4-DIFLUOROBENZALDEHYDE
• 3-Chloro-2,4-difluorobenzaldehyde97%
• 3-Chloro-2,4-difluorobenzaldehyde 97%

Benzaldehyde, 3-chloro-2,4-difluoro-

CAS: 127675-46-1

Formula: C₇H₃ClF₂O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 176.5479

Ref: IN-DA000XAE

3-Chloro-2,4-difluorobenzaldehyde

CAS: 127675-46-1

3-Chloro-2,4-difluorobenzaldehyde

Purity: 99%

Color and Shape: Pale Yellow Liquid

Molecular weight: 176.55g/mol

Ref: 54-PC2571

3-Chloro-2,4-difluoro-benzaldehyde

CAS: 127675-46-1

Formula: C₇H₃ClF₂O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 176.55

Ref: 10-F032925