CymitQuimica logo

CAS 127676-18-0

:

2-(5-Ethyl-2-pyridinyl)-1,3-propanediol

Description:
2-(5-Ethyl-2-pyridinyl)-1,3-propanediol, with the CAS number 127676-18-0, is a chemical compound characterized by its unique structure that includes a pyridine ring and a propanediol moiety. This compound features an ethyl substituent on the pyridine ring, which contributes to its hydrophobic characteristics. The presence of hydroxyl groups in the propanediol part of the molecule enhances its potential for hydrogen bonding, making it soluble in polar solvents. It may exhibit biological activity due to its structural features, which can interact with various biological targets. The compound's molecular structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis. Additionally, its stability and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry and material science. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C10H15NO2
InChI:InChI=1S/C10H15NO2/c1-2-8-3-4-10(11-5-8)9(6-12)7-13/h3-5,9,12-13H,2,6-7H2,1H3
InChI key:InChIKey=YNAYNPZHSUGQLS-UHFFFAOYSA-N
SMILES:C(CO)(CO)C1=CC=C(CC)C=N1
Synonyms:
  • 1,3-Propanediol, 2-(5-Ethyl-2-Pyridinyl)-
  • 2-(5-Ethyl-2-pyridinyl)-1,3-propanediol
  • 2-(5-Ethylpyridin-2-yl)propane-1,3-diol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.