CAS 127680-91-5
:2-(4-Morpholinyl)-4-pyridinecarbonitrile
Description:
2-(4-Morpholinyl)-4-pyridinecarbonitrile, with the CAS number 127680-91-5, is a chemical compound characterized by its pyridine and morpholine functional groups. It features a pyridine ring substituted with a cyano group and a morpholine moiety, which contributes to its potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the morpholine ring, which is often associated with bioactive compounds. The cyano group can enhance the compound's reactivity and may participate in various chemical reactions. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H11N3O
InChI:InChI=1S/C10H11N3O/c11-8-9-1-2-12-10(7-9)13-3-5-14-6-4-13/h1-2,7H,3-6H2
InChI key:InChIKey=ZKBSABVDSSVALF-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(N=CC1)N2CCOCC2
Synonyms:- 4-Cyano-2-(4-morpholinyl)pyridine
- 2-(4-Morpholinyl)-4-pyridinecarbonitrile
- 4-Pyridinecarbonitrile, 2-(4-morpholinyl)-
- 2-Morpholinoisonicotinonitrile
- 2-Morpholinopyridine-4-carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Pyridinecarbonitrile, 2-(4-morpholinyl)-
CAS:Formula:C10H11N3OPurity:98%Color and Shape:SolidMolecular weight:189.21382-Morpholin-4-ylisonicotinonitrile
CAS:2-Morpholin-4-ylisonicotinonitrilePurity:≥95%Molecular weight:189.21g/mol2-Morpholinoisonicotinonitrile
CAS:2-Morpholinoisonicotinonitrile is a fluorescent probe that is used to detect cellular mitochondrial activity. The pyridine ring in 2-morpholinopyridine has been modified with an isonicotinonitrile group, which fluoresces at a wavelength of 510 nm when illuminated with light at 350 nm. The fluorescence quantum yield of this compound is 0.2% and the excited state lifetime is 6 ns. This compound can be used to stain mitochondria in cells observed under the microscope and it can also be used as a marker for live cells. 2-Morpholinoisonicotinonitrile can be dissolved in solvents such as acetone, chloroform, or dimethyl sulfoxide (DMSO). It has been shown that when 2-morpholinoisonicotinonitrile interacts with an anion, it will emit light at 620 nm. This property makes it useful for modulating the pH of solutionsFormula:C10H11N3OPurity:Min. 95%Molecular weight:189.22 g/mol



