CAS 127680-91-5: 2-(4-Morpholinyl)-4-pyridinecarbonitrile
Description:2-(4-Morpholinyl)-4-pyridinecarbonitrile, with the CAS number 127680-91-5, is a chemical compound characterized by its pyridine and morpholine functional groups. It features a pyridine ring substituted with a cyano group and a morpholine moiety, which contributes to its potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the morpholine ring, which is often associated with bioactive compounds. The cyano group can enhance the compound's reactivity and may participate in various chemical reactions. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H11N3O
InChI:InChI=1S/C10H11N3O/c11-8-9-1-2-12-10(7-9)13-3-5-14-6-4-13/h1-2,7H,3-6H2
InChI key:InChIKey=ZKBSABVDSSVALF-UHFFFAOYSA-N
SMILES:N#CC=1C=CN=C(C1)N2CCOCC2
- Synonyms:
- 4-Cyano-2-(4-morpholinyl)pyridine
- 2-(4-Morpholinyl)-4-pyridinecarbonitrile
- 4-Pyridinecarbonitrile, 2-(4-morpholinyl)-
- 2-Morpholinoisonicotinonitrile
- 2-Morpholinopyridine-4-carbonitrile
4-Pyridinecarbonitrile, 2-(4-morpholinyl)-
Ref: IN-DA000XA2
| 1g | 117.00 € | ||
| 5g | 286.00 € | ||
| 250mg | 61.00 € |
Ref: 10-F300864
| 1g | To inquire | ||
| 5g | To inquire | ||
| 250mg | To inquire |
2-Morpholinoisonicotinonitrile
Ref: 3D-CFA68091
| 10g | 489.00 € |
