CAS 127692-24-4
:6'-nitrospiro[cyclohexane-1,2'-imidazo[2,1-b][1,3]oxazole]
Description:
6'-Nitrospiro[cyclohexane-1,2'-imidazo[2,1-b][1,3]oxazole] is a chemical compound characterized by its unique spirocyclic structure, which combines a cyclohexane ring with an imidazo[2,1-b][1,3]oxazole moiety. The presence of a nitro group at the 6' position contributes to its reactivity and potential applications in medicinal chemistry. This compound exhibits properties typical of heterocyclic compounds, including potential biological activity, which may be influenced by the electron-withdrawing nature of the nitro group. The imidazo[2,1-b][1,3]oxazole framework is known for its role in various pharmacological activities, making this compound of interest for research in drug development. Its structural complexity allows for diverse interactions with biological targets, which can be explored in various assays. Additionally, the stability and solubility of this compound can vary based on its substituents and the conditions under which it is studied, impacting its utility in synthetic and medicinal chemistry applications.
Formula:C10H13N3O3
InChI:InChI=1/C10H13N3O3/c14-13(15)8-6-12-7-10(16-9(12)11-8)4-2-1-3-5-10/h6H,1-5,7H2
Synonyms:- Spiro[cyclohexane-1,2'(3'H)-imidazo[2,1-b]oxazole], 6'-nitro-
- Spiro(cyclohexane-1,2'(3'H)-imidazo(2,1-b)oxazole), 6'-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.