CAS 127718-44-9
:2-(2-chlorophenyl)-5-phenyl-3-[(4-phenylpiperazin-1-yl)acetyl]-2H-tetrazol-3-ium chloride
Description:
2-(2-Chlorophenyl)-5-phenyl-3-[(4-phenylpiperazin-1-yl)acetyl]-2H-tetrazol-3-ium chloride, with the CAS number 127718-44-9, is a chemical compound characterized by its complex structure, which includes a tetrazole ring, a chlorophenyl group, and a piperazine moiety. This compound is typically classified as a tetrazolium salt, which often exhibits biological activity, particularly in pharmacological contexts. The presence of the piperazine group suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry, especially for developing psychoactive or therapeutic agents. The chloride ion indicates that it is a salt, which can influence its solubility and stability in various solvents. Additionally, the compound's structure may impart specific properties such as lipophilicity or hydrophilicity, affecting its bioavailability and interaction with biological targets. Overall, this compound's unique features make it a subject of interest for further research in drug development and related fields.
Formula:C25H24Cl2N6O
InChI:InChI=1/C25H24ClN6O.ClH/c26-22-13-7-8-14-23(22)31-27-25(20-9-3-1-4-10-20)28-32(31)24(33)19-29-15-17-30(18-16-29)21-11-5-2-6-12-21;/h1-14H,15-19H2;1H/q+1;/p-1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-Tetrazolium, 3-(2-chlorophenyl)-5-phenyl-2-[2-(4-phenyl-1-piperazinyl)acetyl]-, chloride (1:1)
CAS:Formula:C25H26Cl2N6OMolecular weight:497.4195
