
CAS 127727-79-1
:1-Ethoxy-4-[2-(4-fluorophenyl)ethynyl]benzene
Description:
1-Ethoxy-4-[2-(4-fluorophenyl)ethynyl]benzene, with the CAS number 127727-79-1, is an organic compound characterized by its ethoxy and ethynyl functional groups attached to a benzene ring. This compound features a fluorinated phenyl group, which can influence its electronic properties and reactivity. The presence of the ethoxy group enhances its solubility in organic solvents, making it useful in various chemical applications. The ethynyl group contributes to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the fluorine atom can impart unique characteristics such as increased lipophilicity and altered biological activity. The compound's structure suggests it may exhibit interesting optical or electronic properties, which could be explored in materials science. Overall, 1-Ethoxy-4-[2-(4-fluorophenyl)ethynyl]benzene is a versatile compound with potential applications in various fields, including medicinal chemistry and materials development.
Formula:C16H13FO
InChI:InChI=1S/C16H13FO/c1-2-18-16-11-7-14(8-12-16)4-3-13-5-9-15(17)10-6-13/h5-12H,2H2,1H3
InChI key:InChIKey=SPWWAWOPYSOPDE-UHFFFAOYSA-N
SMILES:C(#CC1=CC=C(F)C=C1)C2=CC=C(OCC)C=C2
Synonyms:- 1-Ethoxy-4-[2-(4-fluorophenyl)ethynyl]benzene
- Benzene, 1-ethoxy-4-[2-(4-fluorophenyl)ethynyl]-
- Benzene, 1-ethoxy-4-[(4-fluorophenyl)ethynyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
