
CAS 127745-40-8
:(2Z)-2-(Hydroxyimino)-3-oxo-N-phenylbutanamide
Description:
(2Z)-2-(Hydroxyimino)-3-oxo-N-phenylbutanamide, with the CAS number 127745-40-8, is a chemical compound characterized by its unique structural features, including a hydroxyimino functional group and a phenyl substituent. This compound typically exhibits properties associated with both amides and oximes, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the hydroxyimino group. It may display moderate solubility in polar solvents, influenced by its functional groups, and could participate in various chemical reactions, including nucleophilic attacks and rearrangements. The presence of the phenyl group suggests that it may also exhibit aromatic characteristics, potentially affecting its stability and reactivity. Additionally, this compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or applications would require further investigation. Overall, its structural complexity and functional groups contribute to its chemical behavior and potential utility in various chemical contexts.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c1-7(13)9(12-15)10(14)11-8-5-3-2-4-6-8/h2-6,15H,1H3,(H,11,14)/b12-9-
InChI key:InChIKey=UWYXIAWYMDVVGK-XFXZXTDPSA-N
SMILES:C(\C(NC1=CC=CC=C1)=O)(/C(C)=O)=N\O
Synonyms:- (2Z)-2-(Hydroxyimino)-3-oxo-N-phenylbutanamide
- Butanamide, 2-(hydroxyimino)-3-oxo-N-phenyl-, (2Z)-
- Butanamide, 2-(hydroxyimino)-3-oxo-N-phenyl-, (Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.