CAS 127761-72-2
:hirudin (54-64), N(alpha)-dinitrofluorobenzyl-
Description:
Hirudin (54-64), N(alpha)-dinitrofluorobenzyl- is a synthetic derivative of hirudin, a potent anticoagulant peptide originally derived from leeches. This compound is characterized by its specific amino acid sequence, which plays a crucial role in its ability to inhibit thrombin, an enzyme involved in blood coagulation. The presence of the N(alpha)-dinitrofluorobenzyl group suggests modifications that may enhance its pharmacological properties, such as increased stability or bioavailability. Hirudin derivatives are often studied for their potential therapeutic applications in treating thrombotic disorders. The CAS number 127761-72-2 uniquely identifies this compound in chemical databases, facilitating research and regulatory processes. Overall, the characteristics of this substance highlight its significance in medicinal chemistry, particularly in the development of anticoagulant therapies.
Formula:C68H88FN13O27
InChI:InChI=1/C68H88FN13O27/c1-5-35(4)58(67(103)80-25-9-12-49(80)66(102)75-43(19-23-55(89)90)60(96)72-42(18-22-54(87)88)61(97)76-46(28-37-13-15-39(83)16-14-37)64(100)78-48(68(104)105)26-34(2)3)79-62(98)44(20-24-56(91)92)73-59(95)41(17-21-53(85)86)74-63(99)45(27-36-10-7-6-8-11-36)77-65(101)47(30-57(93)94)71-52(84)33-70-32-38-29-40(69)51(82(108)109)31-50(38)81(106)107/h6-8,10-11,13-16,29,31,34-35,41-49,58,70,83H,5,9,12,17-28,30,32-33H2,1-4H3,(H,71,84)(H,72,96)(H,73,95)(H,74,99)(H,75,102)(H,76,97)(H,77,101)(H,78,100)(H,79,98)(H,85,86)(H,87,88)(H,89,90)(H,91,92)(H,93,94)(H,104,105)/t35-,41-,42-,43-,44-,45-,46-,47-,48-,49-,58-/m0/s1
Synonyms:- Dnfb-hirudin (54-64)
- N(alpha)-(Dinitrifluorobenzyl)hirudin (54-64)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Hirudin (54-64), N(α)-dinitrofluorobenzyl
CAS:Custom research peptide; min purity 95%. For different specs please use the Peptide Quote Tool
Formula:C68H88FN13O27Molecular weight:1,538.5 g/mol
