CAS 127793-87-7
:2-(Ethylamino)-4,5-dihydroxybenzamide
Description:
2-(Ethylamino)-4,5-dihydroxybenzamide, with the CAS number 127793-87-7, is an organic compound characterized by its aromatic structure featuring a benzamide core substituted with both ethylamino and hydroxyl groups. The presence of the ethylamino group contributes to its basicity and potential for forming hydrogen bonds, while the hydroxyl groups enhance its solubility in polar solvents and may participate in various chemical reactions, such as oxidation or esterification. This compound is likely to exhibit moderate to high polarity due to the functional groups present, influencing its interactions in biological systems and potential applications in pharmaceuticals or agrochemicals. Additionally, the dihydroxy substitution pattern can affect its reactivity and stability, making it a subject of interest in medicinal chemistry for the development of therapeutic agents. Overall, the unique combination of functional groups in 2-(Ethylamino)-4,5-dihydroxybenzamide suggests diverse chemical behavior and potential utility in various chemical and biological contexts.
Formula:C9H12N2O3
InChI:InChI=1S/C9H12N2O3/c1-2-11-6-4-8(13)7(12)3-5(6)9(10)14/h3-4,11-13H,2H2,1H3,(H2,10,14)
InChI key:InChIKey=VAWDXOCBSZJIEL-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(NCC)C=C(O)C(O)=C1
Synonyms:- Benzamide, 2-(ethylamino)-4,5-dihydroxy-
- 2-(Ethylamino)-4,5-dihydroxybenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
