CAS 127806-47-7

2-[[1-(Phenylmethyl)-4-piperidinyl]oxy]pyridine

Description:

2-[[1-(Phenylmethyl)-4-piperidinyl]oxy]pyridine, with the CAS number 127806-47-7, is a chemical compound that belongs to the class of piperidine derivatives. It features a pyridine ring substituted with a piperidine moiety that is further substituted with a phenylmethyl group. This structure contributes to its potential pharmacological properties, as piperidine derivatives are often associated with various biological activities, including analgesic and antipsychotic effects. The compound is typically characterized by its molecular weight, solubility in organic solvents, and specific reactivity patterns due to the presence of both the piperidine and pyridine functionalities. Its synthesis may involve multi-step organic reactions, and it is important to handle it with care due to potential biological activity. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as temperature and pH. Further studies are often required to fully elucidate its properties and potential applications in medicinal chemistry.

Formula: C₁₇H₂₀N₂O

InChI: InChI=1S/C17H20N2O/c1-2-6-15(7-3-1)14-19-12-9-16(10-13-19)20-17-8-4-5-11-18-17/h1-8,11,16H,9-10,12-14H2

InChI key: InChIKey=HNHASBKGUONVGM-UHFFFAOYSA-N

SMILES: O(C1CCN(CC2=CC=CC=C2)CC1)C3=CC=CC=N3

Synonyms:

• 2-[[1-(Phenylmethyl)-4-piperidinyl]oxy]pyridine
• Pyridine, 2-[[1-(phenylmethyl)-4-piperidinyl]oxy]-
• 2-(1-Benzylpiperidin-4-yloxy)pyridine